C38H53FO7 — CID 70615563
(Z)-7-[(1R,2R,3R,5S)-2-[(E)-5-(2-fluorophenyl)-3-(oxan-2-yloxy)pent-1-en-4-ynyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-5-en-1-ol (PubChem CID 70615563) has the molecular formula C38H53FO7 and a molecular weight of 640.83 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5S)-2-[(E)-5-(2-fluorophenyl)-3-(oxan-2-yloxy)pent-1-en-4-ynyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-5-en-1-ol.
| Compound Name | (Z)-7-[(1R,2R,3R,5S)-2-[(E)-5-(2-fluorophenyl)-3-(oxan-2-yloxy)pent-1-en-4-ynyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-5-en-1-ol |
|---|---|
| PubChem CID | 70615563 |
| Molecular Formula | C38H53FO7 |
| Molecular Weight | 640.83 g/mol |
| Exact Mass | 640.38 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-2-[(E)-5-(2-fluorophenyl)-3-(oxan-2-yloxy)pent-1-en-4-ynyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-5-en-1-ol |
| SMILES | OCCCC/C=C\C[C@@H]1[C@@H](/C=C/C(C#Cc2ccccc2F)OC2CCCCO2)[C@H](OC2CCCCO2)C[C@@H]1OC1CCCCO1 |
| InChI | InChI=1S/C38H53FO7/c39-33-16-6-5-14-29(33)20-21-30(44-36-17-7-11-25-41-36)22-23-32-31(15-4-2-1-3-10-24-40)34(45-37-18-8-12-26-42-37)28-35(32)46-38-19-9-13-27-43-38/h2,4-6,14,16,22-23,30-32,34-38,40H,1,3,7-13,15,17-19,24-28H2/b4-2-,23-22+/t30?,31-,32-,34+,35-,36?,37?,38?/m1/s1 |
| InChIKey | YCCNEGUDCJRYOW-RPUKGUBUSA-N |
| XLogP | 7.21 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.83 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|