C12H20N2O4 — CID 70615578
2-methyl-3-(2,2,6,6-tetramethyl-3,5-dioxopiperazin-1-yl)propanoic acid (PubChem CID 70615578) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is 2-methyl-3-(2,2,6,6-tetramethyl-3,5-dioxopiperazin-1-yl)propanoic acid.
| Compound Name | 2-methyl-3-(2,2,6,6-tetramethyl-3,5-dioxopiperazin-1-yl)propanoic acid |
|---|---|
| PubChem CID | 70615578 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 2-methyl-3-(2,2,6,6-tetramethyl-3,5-dioxopiperazin-1-yl)propanoic acid |
| SMILES | CC(CN1C(C)(C)C(=O)NC(=O)C1(C)C)C(=O)O |
| InChI | InChI=1S/C12H20N2O4/c1-7(8(15)16)6-14-11(2,3)9(17)13-10(18)12(14,4)5/h7H,6H2,1-5H3,(H,15,16)(H,13,17,18) |
| InChIKey | IVDJKPGYFDNLTP-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|