About 2-cyclohexa-2,4-dien-1-yl-1,4-oxathiine
2-cyclohexa-2,4-dien-1-yl-1,4-oxathiine (PubChem CID 70615689) has the molecular formula C10H10OS
and a molecular weight of 178.26 g/mol. Its IUPAC name is 2-cyclohexa-2,4-dien-1-yl-1,4-oxathiine.
Molecular Properties
| Compound Name | 2-cyclohexa-2,4-dien-1-yl-1,4-oxathiine |
| PubChem CID | 70615689 |
| Molecular Formula | C10H10OS |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 2-cyclohexa-2,4-dien-1-yl-1,4-oxathiine |
| SMILES | C1=CCC(C2=CSC=CO2)C=C1 |
| InChI | InChI=1S/C10H10OS/c1-2-4-9(5-3-1)10-8-12-7-6-11-10/h1-4,6-9H,5H2 |
| InChIKey | VASDECVNFGDBJQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclohexa-2,4-dien-1-yl-1,4-oxathiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexa-2,4-dien-1-yl-1,4-oxathiine?
The IUPAC name of 2-cyclohexa-2,4-dien-1-yl-1,4-oxathiine (CID 70615689) is 2-cyclohexa-2,4-dien-1-yl-1,4-oxathiine.
What is the SMILES notation for 2-cyclohexa-2,4-dien-1-yl-1,4-oxathiine?
The canonical SMILES for 2-cyclohexa-2,4-dien-1-yl-1,4-oxathiine is C1=CCC(C2=CSC=CO2)C=C1.
What is the InChIKey of 2-cyclohexa-2,4-dien-1-yl-1,4-oxathiine?
The InChIKey is VASDECVNFGDBJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10OS/c1-2-4-9(5-3-1)10-8-12-7-6-11-10/h1-4,6-9H,5H2.
What are the key properties of 2-cyclohexa-2,4-dien-1-yl-1,4-oxathiine?
2-cyclohexa-2,4-dien-1-yl-1,4-oxathiine has a molecular weight of 178.26 g/mol, XLogP of 3.19, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexa-2,4-dien-1-yl-1,4-oxathiine is sourced from PubChem (CID 70615689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).