C24H30ClF3N4O4 — CID 70616060
benzyl N-[(5S)-5-amino-6-oxo-6-[[(2S)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl]amino]hexyl]carbamate;hydrochloride (PubChem CID 70616060) has the molecular formula C24H30ClF3N4O4 and a molecular weight of 530.98 g/mol. Its IUPAC name is benzyl N-[(5S)-5-amino-6-oxo-6-[[(2S)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl]amino]hexyl]carbamate;hydrochloride.
| Compound Name | benzyl N-[(5S)-5-amino-6-oxo-6-[[(2S)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl]amino]hexyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 70616060 |
| Molecular Formula | C24H30ClF3N4O4 |
| Molecular Weight | 530.98 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | benzyl N-[(5S)-5-amino-6-oxo-6-[[(2S)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl]amino]hexyl]carbamate;hydrochloride |
| SMILES | C[C@H](NC(=O)[C@@H](N)CCCCNC(=O)OCc1ccccc1)C(=O)Nc1ccc(C(F)(F)F)cc1.Cl |
| InChI | InChI=1S/C24H29F3N4O4.ClH/c1-16(21(32)31-19-12-10-18(11-13-19)24(25,26)27)30-22(33)20(28)9-5-6-14-29-23(34)35-15-17-7-3-2-4-8-17;/h2-4,7-8,10-13,16,20H,5-6,9,14-15,28H2,1H3,(H,29,34)(H,30,33)(H,31,32);1H/t16-,20-;/m0./s1 |
| InChIKey | QAOBVUYWWNUHLB-XXRBRTKDSA-N |
| XLogP | 3.99 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.98 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|