C18H19Cl2N5 — CID 70616101
N'-[N'-benzyl-N-[(2,6-dichlorophenyl)methylideneamino]carbamimidoyl]-N,N-dimethylmethanimidamide (PubChem CID 70616101) has the molecular formula C18H19Cl2N5 and a molecular weight of 376.29 g/mol. Its IUPAC name is N'-[N'-benzyl-N-[(2,6-dichlorophenyl)methylideneamino]carbamimidoyl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[N'-benzyl-N-[(2,6-dichlorophenyl)methylideneamino]carbamimidoyl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 70616101 |
| Molecular Formula | C18H19Cl2N5 |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | N'-[N'-benzyl-N-[(2,6-dichlorophenyl)methylideneamino]carbamimidoyl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)C=N/C(=N\Cc1ccccc1)NN=Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H19Cl2N5/c1-25(2)13-22-18(21-11-14-7-4-3-5-8-14)24-23-12-15-16(19)9-6-10-17(15)20/h3-10,12-13H,11H2,1-2H3,(H,21,24) |
| InChIKey | LWRRYWSSYIBWSZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 52.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|