About 3-(piperazine-1,4-diium-1-ylmethyl)-1,2-oxazole
3-(piperazine-1,4-diium-1-ylmethyl)-1,2-oxazole (PubChem CID 7061658) has the molecular formula C8H15N3O+2
and a molecular weight of 169.23 g/mol. Its IUPAC name is 3-(piperazine-1,4-diium-1-ylmethyl)-1,2-oxazole.
Molecular Properties
| Compound Name | 3-(piperazine-1,4-diium-1-ylmethyl)-1,2-oxazole |
| PubChem CID | 7061658 |
| Molecular Formula | C8H15N3O+2 |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 3-(piperazine-1,4-diium-1-ylmethyl)-1,2-oxazole |
| SMILES | c1cc(C[NH+]2CC[NH2+]CC2)no1 |
| InChI | InChI=1S/C8H13N3O/c1-6-12-10-8(1)7-11-4-2-9-3-5-11/h1,6,9H,2-5,7H2/p+2 |
| InChIKey | VJMTXOUUYNPWLF-UHFFFAOYSA-P |
| XLogP | -2.36 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(piperazine-1,4-diium-1-ylmethyl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(piperazine-1,4-diium-1-ylmethyl)-1,2-oxazole?
The IUPAC name of 3-(piperazine-1,4-diium-1-ylmethyl)-1,2-oxazole (CID 7061658) is 3-(piperazine-1,4-diium-1-ylmethyl)-1,2-oxazole.
What is the SMILES notation for 3-(piperazine-1,4-diium-1-ylmethyl)-1,2-oxazole?
The canonical SMILES for 3-(piperazine-1,4-diium-1-ylmethyl)-1,2-oxazole is c1cc(C[NH+]2CC[NH2+]CC2)no1.
What is the InChIKey of 3-(piperazine-1,4-diium-1-ylmethyl)-1,2-oxazole?
The InChIKey is VJMTXOUUYNPWLF-UHFFFAOYSA-P. The full InChI is InChI=1S/C8H13N3O/c1-6-12-10-8(1)7-11-4-2-9-3-5-11/h1,6,9H,2-5,7H2/p+2.
What are the key properties of 3-(piperazine-1,4-diium-1-ylmethyl)-1,2-oxazole?
3-(piperazine-1,4-diium-1-ylmethyl)-1,2-oxazole has a molecular weight of 169.23 g/mol, XLogP of -2.36, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(piperazine-1,4-diium-1-ylmethyl)-1,2-oxazole is sourced from PubChem (CID 7061658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).