C26H41NO2 — CID 70616695
2-[(8S,9S,10R,13S,14S,17R)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-N,N-diethylpropanamide (PubChem CID 70616695) has the molecular formula C26H41NO2 and a molecular weight of 399.62 g/mol. Its IUPAC name is 2-[(8S,9S,10R,13S,14S,17R)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-N,N-diethylpropanamide.
| Compound Name | 2-[(8S,9S,10R,13S,14S,17R)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 70616695 |
| Molecular Formula | C26H41NO2 |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.31 |
| IUPAC Name | 2-[(8S,9S,10R,13S,14S,17R)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H41NO2/c1-6-27(7-2)24(29)17(3)21-10-11-22-20-9-8-18-16-19(28)12-14-25(18,4)23(20)13-15-26(21,22)5/h16-17,20-23H,6-15H2,1-5H3/t17?,20-,21+,22-,23-,25-,26+/m0/s1 |
| InChIKey | LIKVKBAPMMPJCI-UMFRWKOTSA-N |
| XLogP | 5.64 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |