C17H21NO2 — CID 70616755
3-[(3aR)-3a-methyl-3,7-dioxo-1,2,4,5,8,9,9a,9b-octahydrocyclopenta[a]naphthalen-6-yl]propanenitrile (PubChem CID 70616755) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 3-[(3aR)-3a-methyl-3,7-dioxo-1,2,4,5,8,9,9a,9b-octahydrocyclopenta[a]naphthalen-6-yl]propanenitrile.
| Compound Name | 3-[(3aR)-3a-methyl-3,7-dioxo-1,2,4,5,8,9,9a,9b-octahydrocyclopenta[a]naphthalen-6-yl]propanenitrile |
|---|---|
| PubChem CID | 70616755 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 3-[(3aR)-3a-methyl-3,7-dioxo-1,2,4,5,8,9,9a,9b-octahydrocyclopenta[a]naphthalen-6-yl]propanenitrile |
| SMILES | C[C@@]12CCC3=C(CCC#N)C(=O)CCC3C1CCC2=O |
| InChI | InChI=1S/C17H21NO2/c1-17-9-8-11-12(14(17)5-7-16(17)20)4-6-15(19)13(11)3-2-10-18/h12,14H,2-9H2,1H3/t12?,14?,17-/m1/s1 |
| InChIKey | WHGJQABVPXIZCL-MKTAYPAQSA-N |
| XLogP | 3.35 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |