C18H27NO3 — CID 70616760
4-(4a-hydroxy-6a-methyl-7-oxo-1,2,3,5,6,8,9,10,10a,10b-decahydrobenzo[f]chromen-3-yl)butanenitrile (PubChem CID 70616760) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is 4-(4a-hydroxy-6a-methyl-7-oxo-1,2,3,5,6,8,9,10,10a,10b-decahydrobenzo[f]chromen-3-yl)butanenitrile.
| Compound Name | 4-(4a-hydroxy-6a-methyl-7-oxo-1,2,3,5,6,8,9,10,10a,10b-decahydrobenzo[f]chromen-3-yl)butanenitrile |
|---|---|
| PubChem CID | 70616760 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 4-(4a-hydroxy-6a-methyl-7-oxo-1,2,3,5,6,8,9,10,10a,10b-decahydrobenzo[f]chromen-3-yl)butanenitrile |
| SMILES | CC12CCC3(O)OC(CCCC#N)CCC3C1CCCC2=O |
| InChI | InChI=1S/C18H27NO3/c1-17-10-11-18(21)15(14(17)6-4-7-16(17)20)9-8-13(22-18)5-2-3-12-19/h13-15,21H,2-11H2,1H3 |
| InChIKey | DPHAOEPVDZXPDG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|