C13H16F3NO6 — CID 706168
(2S,3S,4R,5R,6R)-2-(hydroxymethyl)-6-[4-(trifluoromethoxy)anilino]oxane-3,4,5-triol (PubChem CID 706168) has the molecular formula C13H16F3NO6 and a molecular weight of 339.27 g/mol. Its IUPAC name is (2S,3S,4R,5R,6R)-2-(hydroxymethyl)-6-[4-(trifluoromethoxy)anilino]oxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5R,6R)-2-(hydroxymethyl)-6-[4-(trifluoromethoxy)anilino]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 706168 |
| Molecular Formula | C13H16F3NO6 |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | (2S,3S,4R,5R,6R)-2-(hydroxymethyl)-6-[4-(trifluoromethoxy)anilino]oxane-3,4,5-triol |
| SMILES | OC[C@@H]1O[C@@H](Nc2ccc(OC(F)(F)F)cc2)[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H16F3NO6/c14-13(15,16)23-7-3-1-6(2-4-7)17-12-11(21)10(20)9(19)8(5-18)22-12/h1-4,8-12,17-21H,5H2/t8-,9+,10+,11+,12+/m0/s1 |
| InChIKey | XIYLYQRUHQXBBZ-VSSNEEPJSA-N |
| XLogP | -0.20 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|