C9H19NO2S — CID 70616864
2-(3-pyrrolidin-1-ylpropylsulfanyl)ethane-1,1-diol (PubChem CID 70616864) has the molecular formula C9H19NO2S and a molecular weight of 205.32 g/mol. Its IUPAC name is 2-(3-pyrrolidin-1-ylpropylsulfanyl)ethane-1,1-diol.
| Compound Name | 2-(3-pyrrolidin-1-ylpropylsulfanyl)ethane-1,1-diol |
|---|---|
| PubChem CID | 70616864 |
| Molecular Formula | C9H19NO2S |
| Molecular Weight | 205.32 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2-(3-pyrrolidin-1-ylpropylsulfanyl)ethane-1,1-diol |
| SMILES | OC(O)CSCCCN1CCCC1 |
| InChI | InChI=1S/C9H19NO2S/c11-9(12)8-13-7-3-6-10-4-1-2-5-10/h9,11-12H,1-8H2 |
| InChIKey | CGBHAECWNHCXNI-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.32 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|