C11H16N2 — CID 70617087
(4aR,9bR)-2,3,4,4a,5,5a,9a,9b-octahydro-1H-pyrido[4,3-b]indole (PubChem CID 70617087) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is (4aR,9bR)-2,3,4,4a,5,5a,9a,9b-octahydro-1H-pyrido[4,3-b]indole.
| Compound Name | (4aR,9bR)-2,3,4,4a,5,5a,9a,9b-octahydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 70617087 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | (4aR,9bR)-2,3,4,4a,5,5a,9a,9b-octahydro-1H-pyrido[4,3-b]indole |
| SMILES | C1=CC2N[C@@H]3CCNC[C@H]3C2C=C1 |
| InChI | InChI=1S/C11H16N2/c1-2-4-10-8(3-1)9-7-12-6-5-11(9)13-10/h1-4,8-13H,5-7H2/t8?,9-,10?,11+/m0/s1 |
| InChIKey | PZOQPMHATGPFOW-QONHTCSSSA-N |
| XLogP | 0.68 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |