About 4-chloro-2-(2,6-dimethylanilino)-N-prop-2-enylbutanamide
4-chloro-2-(2,6-dimethylanilino)-N-prop-2-enylbutanamide (PubChem CID 70617095) has the molecular formula C15H21ClN2O
and a molecular weight of 280.80 g/mol. Its IUPAC name is 4-chloro-2-(2,6-dimethylanilino)-N-prop-2-enylbutanamide.
Molecular Properties
| Compound Name | 4-chloro-2-(2,6-dimethylanilino)-N-prop-2-enylbutanamide |
| PubChem CID | 70617095 |
| Molecular Formula | C15H21ClN2O |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 4-chloro-2-(2,6-dimethylanilino)-N-prop-2-enylbutanamide |
| SMILES | C=CCNC(=O)C(CCCl)Nc1c(C)cccc1C |
| InChI | InChI=1S/C15H21ClN2O/c1-4-10-17-15(19)13(8-9-16)18-14-11(2)6-5-7-12(14)3/h4-7,13,18H,1,8-10H2,2-3H3,(H,17,19) |
| InChIKey | MLULOSVHYIHQDP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-(2,6-dimethylanilino)-N-prop-2-enylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(2,6-dimethylanilino)-N-prop-2-enylbutanamide?
The IUPAC name of 4-chloro-2-(2,6-dimethylanilino)-N-prop-2-enylbutanamide (CID 70617095) is 4-chloro-2-(2,6-dimethylanilino)-N-prop-2-enylbutanamide.
What is the SMILES notation for 4-chloro-2-(2,6-dimethylanilino)-N-prop-2-enylbutanamide?
The canonical SMILES for 4-chloro-2-(2,6-dimethylanilino)-N-prop-2-enylbutanamide is C=CCNC(=O)C(CCCl)Nc1c(C)cccc1C.
What is the InChIKey of 4-chloro-2-(2,6-dimethylanilino)-N-prop-2-enylbutanamide?
The InChIKey is MLULOSVHYIHQDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21ClN2O/c1-4-10-17-15(19)13(8-9-16)18-14-11(2)6-5-7-12(14)3/h4-7,13,18H,1,8-10H2,2-3H3,(H,17,19).
What are the key properties of 4-chloro-2-(2,6-dimethylanilino)-N-prop-2-enylbutanamide?
4-chloro-2-(2,6-dimethylanilino)-N-prop-2-enylbutanamide has a molecular weight of 280.80 g/mol, XLogP of 3.02, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(2,6-dimethylanilino)-N-prop-2-enylbutanamide is sourced from PubChem (CID 70617095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).