C22H38O5 — CID 70617219
(2S,3R,4R,6R)-6-methoxy-2-[3-(oxan-2-yloxy)oct-1-enyl]-3-prop-2-enyloxan-4-ol (PubChem CID 70617219) has the molecular formula C22H38O5 and a molecular weight of 382.54 g/mol. Its IUPAC name is (2S,3R,4R,6R)-6-methoxy-2-[3-(oxan-2-yloxy)oct-1-enyl]-3-prop-2-enyloxan-4-ol.
| Compound Name | (2S,3R,4R,6R)-6-methoxy-2-[3-(oxan-2-yloxy)oct-1-enyl]-3-prop-2-enyloxan-4-ol |
|---|---|
| PubChem CID | 70617219 |
| Molecular Formula | C22H38O5 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | (2S,3R,4R,6R)-6-methoxy-2-[3-(oxan-2-yloxy)oct-1-enyl]-3-prop-2-enyloxan-4-ol |
| SMILES | C=CC[C@@H]1[C@H](O)C[C@H](OC)O[C@H]1C=CC(CCCCC)OC1CCCCO1 |
| InChI | InChI=1S/C22H38O5/c1-4-6-7-11-17(26-21-12-8-9-15-25-21)13-14-20-18(10-5-2)19(23)16-22(24-3)27-20/h5,13-14,17-23H,2,4,6-12,15-16H2,1,3H3/t17?,18-,19-,20+,21?,22-/m1/s1 |
| InChIKey | CGEDIPUQSKAQEZ-FFXCYSNMSA-N |
| XLogP | 4.35 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|