C26H41NO — CID 70617268
(9Z,12Z)-N-benzyl-N-methyloctadeca-9,12-dienamide (PubChem CID 70617268) has the molecular formula C26H41NO and a molecular weight of 383.62 g/mol. Its IUPAC name is (9Z,12Z)-N-benzyl-N-methyloctadeca-9,12-dienamide.
| Compound Name | (9Z,12Z)-N-benzyl-N-methyloctadeca-9,12-dienamide |
|---|---|
| PubChem CID | 70617268 |
| Molecular Formula | C26H41NO |
| Molecular Weight | 383.62 g/mol |
| Exact Mass | 383.32 |
| IUPAC Name | (9Z,12Z)-N-benzyl-N-methyloctadeca-9,12-dienamide |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C26H41NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-23-26(28)27(2)24-25-21-18-17-19-22-25/h7-8,10-11,17-19,21-22H,3-6,9,12-16,20,23-24H2,1-2H3/b8-7-,11-10- |
| InChIKey | DGCSEGDXJDLMCV-NQLNTKRDSA-N |
| XLogP | 7.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.62 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|