About 4,5-dimethyl-3,4-bis(4-propan-2-ylpiperidin-1-yl)hexan-2-one
4,5-dimethyl-3,4-bis(4-propan-2-ylpiperidin-1-yl)hexan-2-one (PubChem CID 70617722) has the molecular formula C24H46N2O
and a molecular weight of 378.65 g/mol. Its IUPAC name is 4,5-dimethyl-3,4-bis(4-propan-2-ylpiperidin-1-yl)hexan-2-one.
Molecular Properties
| Compound Name | 4,5-dimethyl-3,4-bis(4-propan-2-ylpiperidin-1-yl)hexan-2-one |
| PubChem CID | 70617722 |
| Molecular Formula | C24H46N2O |
| Molecular Weight | 378.65 g/mol |
| Exact Mass | 378.36 |
| IUPAC Name | 4,5-dimethyl-3,4-bis(4-propan-2-ylpiperidin-1-yl)hexan-2-one |
| SMILES | CC(=O)C(N1CCC(C(C)C)CC1)C(C)(C(C)C)N1CCC(C(C)C)CC1 |
| InChI | InChI=1S/C24H46N2O/c1-17(2)21-9-13-25(14-10-21)23(20(7)27)24(8,19(5)6)26-15-11-22(12-16-26)18(3)4/h17-19,21-23H,9-16H2,1-8H3 |
| InChIKey | BWTFGCJOHHGXEL-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.65 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-dimethyl-3,4-bis(4-propan-2-ylpiperidin-1-yl)hexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-3,4-bis(4-propan-2-ylpiperidin-1-yl)hexan-2-one?
The IUPAC name of 4,5-dimethyl-3,4-bis(4-propan-2-ylpiperidin-1-yl)hexan-2-one (CID 70617722) is 4,5-dimethyl-3,4-bis(4-propan-2-ylpiperidin-1-yl)hexan-2-one.
What is the SMILES notation for 4,5-dimethyl-3,4-bis(4-propan-2-ylpiperidin-1-yl)hexan-2-one?
The canonical SMILES for 4,5-dimethyl-3,4-bis(4-propan-2-ylpiperidin-1-yl)hexan-2-one is CC(=O)C(N1CCC(C(C)C)CC1)C(C)(C(C)C)N1CCC(C(C)C)CC1.
What is the InChIKey of 4,5-dimethyl-3,4-bis(4-propan-2-ylpiperidin-1-yl)hexan-2-one?
The InChIKey is BWTFGCJOHHGXEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H46N2O/c1-17(2)21-9-13-25(14-10-21)23(20(7)27)24(8,19(5)6)26-15-11-22(12-16-26)18(3)4/h17-19,21-23H,9-16H2,1-8H3.
What are the key properties of 4,5-dimethyl-3,4-bis(4-propan-2-ylpiperidin-1-yl)hexan-2-one?
4,5-dimethyl-3,4-bis(4-propan-2-ylpiperidin-1-yl)hexan-2-one has a molecular weight of 378.65 g/mol, XLogP of 5.09, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-3,4-bis(4-propan-2-ylpiperidin-1-yl)hexan-2-one is sourced from PubChem (CID 70617722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).