C12H20O6 — CID 70617812
(3S,4R,5S)-2-(1-hydroxy-2-methylprop-1-enyl)-6-propan-2-ylideneoxane-2,3,4,5-tetrol (PubChem CID 70617812) has the molecular formula C12H20O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is (3S,4R,5S)-2-(1-hydroxy-2-methylprop-1-enyl)-6-propan-2-ylideneoxane-2,3,4,5-tetrol.
| Compound Name | (3S,4R,5S)-2-(1-hydroxy-2-methylprop-1-enyl)-6-propan-2-ylideneoxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 70617812 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (3S,4R,5S)-2-(1-hydroxy-2-methylprop-1-enyl)-6-propan-2-ylideneoxane-2,3,4,5-tetrol |
| SMILES | CC(C)=C1OC(O)(C(O)=C(C)C)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H20O6/c1-5(2)9-7(13)8(14)11(16)12(17,18-9)10(15)6(3)4/h7-8,11,13-17H,1-4H3/t7-,8+,11-,12?/m0/s1 |
| InChIKey | PBAMFNQWZUAUQG-ZWXQOBOSSA-N |
| XLogP | -0.07 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|