About imidazolidine-2,4-dione;trihydrate
imidazolidine-2,4-dione;trihydrate (PubChem CID 70617866) has the molecular formula C3H10N2O5
and a molecular weight of 154.12 g/mol. Its IUPAC name is imidazolidine-2,4-dione;trihydrate.
Molecular Properties
| Compound Name | imidazolidine-2,4-dione;trihydrate |
| PubChem CID | 70617866 |
| Molecular Formula | C3H10N2O5 |
| Molecular Weight | 154.12 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | imidazolidine-2,4-dione;trihydrate |
| SMILES | O.O.O.O=C1CNC(=O)N1 |
| InChI | InChI=1S/C3H4N2O2.3H2O/c6-2-1-4-3(7)5-2;;;/h1H2,(H2,4,5,6,7);3*1H2 |
| InChIKey | WPNHJUBEGQOKIT-UHFFFAOYSA-N |
| XLogP | -3.65 |
| TPSA | 152.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.12 |
| LogP ≤ 5 | -3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze imidazolidine-2,4-dione;trihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazolidine-2,4-dione;trihydrate?
The IUPAC name of imidazolidine-2,4-dione;trihydrate (CID 70617866) is imidazolidine-2,4-dione;trihydrate.
What is the SMILES notation for imidazolidine-2,4-dione;trihydrate?
The canonical SMILES for imidazolidine-2,4-dione;trihydrate is O.O.O.O=C1CNC(=O)N1.
What is the InChIKey of imidazolidine-2,4-dione;trihydrate?
The InChIKey is WPNHJUBEGQOKIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2O2.3H2O/c6-2-1-4-3(7)5-2;;;/h1H2,(H2,4,5,6,7);3*1H2.
What are the key properties of imidazolidine-2,4-dione;trihydrate?
imidazolidine-2,4-dione;trihydrate has a molecular weight of 154.12 g/mol, XLogP of -3.65, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for imidazolidine-2,4-dione;trihydrate is sourced from PubChem (CID 70617866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).