C15H24O8 — CID 70617972
(4R,5S)-4-hydroxy-5-[(2R,3R)-2-(hydroxymethyl)-1,4-dioxaspiro[4.5]decan-3-yl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid (PubChem CID 70617972) has the molecular formula C15H24O8 and a molecular weight of 332.35 g/mol. Its IUPAC name is (4R,5S)-4-hydroxy-5-[(2R,3R)-2-(hydroxymethyl)-1,4-dioxaspiro[4.5]decan-3-yl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid.
| Compound Name | (4R,5S)-4-hydroxy-5-[(2R,3R)-2-(hydroxymethyl)-1,4-dioxaspiro[4.5]decan-3-yl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
|---|---|
| PubChem CID | 70617972 |
| Molecular Formula | C15H24O8 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | (4R,5S)-4-hydroxy-5-[(2R,3R)-2-(hydroxymethyl)-1,4-dioxaspiro[4.5]decan-3-yl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
| SMILES | CC1(C)O[C@@H]([C@@H]2OC3(CCCCC3)O[C@@H]2CO)[C@](O)(C(=O)O)O1 |
| InChI | InChI=1S/C15H24O8/c1-13(2)22-11(15(19,23-13)12(17)18)10-9(8-16)20-14(21-10)6-4-3-5-7-14/h9-11,16,19H,3-8H2,1-2H3,(H,17,18)/t9-,10-,11+,15-/m1/s1 |
| InChIKey | SOVQJLBHNIYJGB-YYHMBLRTSA-N |
| XLogP | 0.35 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |