About 4-[(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl]benzoic acid
4-[(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl]benzoic acid (PubChem CID 70618307) has the molecular formula C27H26N2O4
and a molecular weight of 442.52 g/mol. Its IUPAC name is 4-[(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl]benzoic acid |
| PubChem CID | 70618307 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 4-[(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl]benzoic acid |
| SMILES | CCCCC1(Cc2ccc(C(=O)O)cc2)C(=O)N(c2ccccc2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C27H26N2O4/c1-2-3-18-27(19-20-14-16-21(17-15-20)24(30)31)25(32)28(22-10-6-4-7-11-22)29(26(27)33)23-12-8-5-9-13-23/h4-17H,2-3,18-19H2,1H3,(H,30,31) |
| InChIKey | RPKSWEJCNGZCFC-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl]benzoic acid?
The IUPAC name of 4-[(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl]benzoic acid (CID 70618307) is 4-[(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl]benzoic acid.
What is the SMILES notation for 4-[(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl]benzoic acid?
The canonical SMILES for 4-[(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl]benzoic acid is CCCCC1(Cc2ccc(C(=O)O)cc2)C(=O)N(c2ccccc2)N(c2ccccc2)C1=O.
What is the InChIKey of 4-[(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl]benzoic acid?
The InChIKey is RPKSWEJCNGZCFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26N2O4/c1-2-3-18-27(19-20-14-16-21(17-15-20)24(30)31)25(32)28(22-10-6-4-7-11-22)29(26(27)33)23-12-8-5-9-13-23/h4-17H,2-3,18-19H2,1H3,(H,30,31).
What are the key properties of 4-[(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl]benzoic acid?
4-[(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl]benzoic acid has a molecular weight of 442.52 g/mol, XLogP of 5.10, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl]benzoic acid is sourced from PubChem (CID 70618307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).