C18H17N3O2S — CID 706184
(2S)-5,6-dimethyl-1'-prop-2-enylspiro[1,3-dihydrothieno[2,3-d]pyrimidine-2,3'-indole]-2',4-dione (PubChem CID 706184) has the molecular formula C18H17N3O2S and a molecular weight of 339.42 g/mol. Its IUPAC name is (2S)-5,6-dimethyl-1'-prop-2-enylspiro[1,3-dihydrothieno[2,3-d]pyrimidine-2,3'-indole]-2',4-dione.
| Compound Name | (2S)-5,6-dimethyl-1'-prop-2-enylspiro[1,3-dihydrothieno[2,3-d]pyrimidine-2,3'-indole]-2',4-dione |
|---|---|
| PubChem CID | 706184 |
| Molecular Formula | C18H17N3O2S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | (2S)-5,6-dimethyl-1'-prop-2-enylspiro[1,3-dihydrothieno[2,3-d]pyrimidine-2,3'-indole]-2',4-dione |
| SMILES | C=CCN1C(=O)[C@]2(NC(=O)c3c(sc(C)c3C)N2)c2ccccc21 |
| InChI | InChI=1S/C18H17N3O2S/c1-4-9-21-13-8-6-5-7-12(13)18(17(21)23)19-15(22)14-10(2)11(3)24-16(14)20-18/h4-8,20H,1,9H2,2-3H3,(H,19,22)/t18-/m0/s1 |
| InChIKey | VVTWCOUPEHHKRP-SFHVURJKSA-N |
| XLogP | 2.91 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|