C15H22O4 — CID 70618453
(1R)-2-methyl-1-[(2-methylpropan-2-yl)oxy]-5-oxo-1,2,3,6,7,7a-hexahydroindene-4-carboxylic acid (PubChem CID 70618453) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (1R)-2-methyl-1-[(2-methylpropan-2-yl)oxy]-5-oxo-1,2,3,6,7,7a-hexahydroindene-4-carboxylic acid.
| Compound Name | (1R)-2-methyl-1-[(2-methylpropan-2-yl)oxy]-5-oxo-1,2,3,6,7,7a-hexahydroindene-4-carboxylic acid |
|---|---|
| PubChem CID | 70618453 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (1R)-2-methyl-1-[(2-methylpropan-2-yl)oxy]-5-oxo-1,2,3,6,7,7a-hexahydroindene-4-carboxylic acid |
| SMILES | CC1CC2=C(C(=O)O)C(=O)CCC2[C@@H]1OC(C)(C)C |
| InChI | InChI=1S/C15H22O4/c1-8-7-10-9(13(8)19-15(2,3)4)5-6-11(16)12(10)14(17)18/h8-9,13H,5-7H2,1-4H3,(H,17,18)/t8?,9?,13-/m1/s1 |
| InChIKey | URNQYDTZQYXYHM-KJHLLKJSSA-N |
| XLogP | 2.57 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|