C11H15N — CID 70618464
2,7-diethyl-7-azabicyclo[4.2.0]octa-1,3,5-triene (PubChem CID 70618464) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 2,7-diethyl-7-azabicyclo[4.2.0]octa-1,3,5-triene.
| Compound Name | 2,7-diethyl-7-azabicyclo[4.2.0]octa-1,3,5-triene |
|---|---|
| PubChem CID | 70618464 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 2,7-diethyl-7-azabicyclo[4.2.0]octa-1,3,5-triene |
| SMILES | CCc1cccc2c1CN2CC |
| InChI | InChI=1S/C11H15N/c1-3-9-6-5-7-11-10(9)8-12(11)4-2/h5-7H,3-4,8H2,1-2H3 |
| InChIKey | PAXIWZAKVHFZGQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |