About 1-(4,5-dihydro-1H-imidazol-2-yl)pent-4-en-1-amine
1-(4,5-dihydro-1H-imidazol-2-yl)pent-4-en-1-amine (PubChem CID 70618628) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is 1-(4,5-dihydro-1H-imidazol-2-yl)pent-4-en-1-amine.
Molecular Properties
| Compound Name | 1-(4,5-dihydro-1H-imidazol-2-yl)pent-4-en-1-amine |
| PubChem CID | 70618628 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 1-(4,5-dihydro-1H-imidazol-2-yl)pent-4-en-1-amine |
| SMILES | C=CCCC(N)C1=NCCN1 |
| InChI | InChI=1S/C8H15N3/c1-2-3-4-7(9)8-10-5-6-11-8/h2,7H,1,3-6,9H2,(H,10,11) |
| InChIKey | BBMHNABJMSCUSV-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,5-dihydro-1H-imidazol-2-yl)pent-4-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-yl)pent-4-en-1-amine?
The IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-yl)pent-4-en-1-amine (CID 70618628) is 1-(4,5-dihydro-1H-imidazol-2-yl)pent-4-en-1-amine.
What is the SMILES notation for 1-(4,5-dihydro-1H-imidazol-2-yl)pent-4-en-1-amine?
The canonical SMILES for 1-(4,5-dihydro-1H-imidazol-2-yl)pent-4-en-1-amine is C=CCCC(N)C1=NCCN1.
What is the InChIKey of 1-(4,5-dihydro-1H-imidazol-2-yl)pent-4-en-1-amine?
The InChIKey is BBMHNABJMSCUSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3/c1-2-3-4-7(9)8-10-5-6-11-8/h2,7H,1,3-6,9H2,(H,10,11).
What are the key properties of 1-(4,5-dihydro-1H-imidazol-2-yl)pent-4-en-1-amine?
1-(4,5-dihydro-1H-imidazol-2-yl)pent-4-en-1-amine has a molecular weight of 153.23 g/mol, XLogP of 0.28, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dihydro-1H-imidazol-2-yl)pent-4-en-1-amine is sourced from PubChem (CID 70618628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).