C19H23FO6 — CID 70618960
(3aR,4R,5R,6aS)-4-[(E)-2-[2-[(4-fluorophenoxy)methyl]-1,3-dioxolan-2-yl]ethenyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol (PubChem CID 70618960) has the molecular formula C19H23FO6 and a molecular weight of 366.39 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-[(E)-2-[2-[(4-fluorophenoxy)methyl]-1,3-dioxolan-2-yl]ethenyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol.
| Compound Name | (3aR,4R,5R,6aS)-4-[(E)-2-[2-[(4-fluorophenoxy)methyl]-1,3-dioxolan-2-yl]ethenyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol |
|---|---|
| PubChem CID | 70618960 |
| Molecular Formula | C19H23FO6 |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-[(E)-2-[2-[(4-fluorophenoxy)methyl]-1,3-dioxolan-2-yl]ethenyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol |
| SMILES | OC1C[C@@H]2[C@@H](/C=C/C3(COc4ccc(F)cc4)OCCO3)[C@H](O)C[C@@H]2O1 |
| InChI | InChI=1S/C19H23FO6/c20-12-1-3-13(4-2-12)23-11-19(24-7-8-25-19)6-5-14-15-9-18(22)26-17(15)10-16(14)21/h1-6,14-18,21-22H,7-11H2/b6-5+/t14-,15-,16-,17+,18?/m1/s1 |
| InChIKey | GLYIPQIASYYGMK-QLTJJAEISA-N |
| XLogP | 1.61 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|