C19H23NO4 — CID 70619100
2-[2-(3,4-dimethoxyphenyl)ethylamino]-1-(2-methoxyphenyl)ethanone (PubChem CID 70619100) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)ethylamino]-1-(2-methoxyphenyl)ethanone.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)ethylamino]-1-(2-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 70619100 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)ethylamino]-1-(2-methoxyphenyl)ethanone |
| SMILES | COc1ccc(CCNCC(=O)c2ccccc2OC)cc1OC |
| InChI | InChI=1S/C19H23NO4/c1-22-17-7-5-4-6-15(17)16(21)13-20-11-10-14-8-9-18(23-2)19(12-14)24-3/h4-9,12,20H,10-11,13H2,1-3H3 |
| InChIKey | RHQZURXFPWEDMR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|