C15H18N4O2 — CID 70619508
[3-(4,5-dihydro-1H-imidazol-2-ylhydrazinylidene)-7-methyl-1,2-dihydroinden-4-yl] acetate (PubChem CID 70619508) has the molecular formula C15H18N4O2 and a molecular weight of 286.34 g/mol. Its IUPAC name is [3-(4,5-dihydro-1H-imidazol-2-ylhydrazinylidene)-7-methyl-1,2-dihydroinden-4-yl] acetate.
| Compound Name | [3-(4,5-dihydro-1H-imidazol-2-ylhydrazinylidene)-7-methyl-1,2-dihydroinden-4-yl] acetate |
|---|---|
| PubChem CID | 70619508 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | [3-(4,5-dihydro-1H-imidazol-2-ylhydrazinylidene)-7-methyl-1,2-dihydroinden-4-yl] acetate |
| SMILES | CC(=O)Oc1ccc(C)c2c1C(=NNC1=NCCN1)CC2 |
| InChI | InChI=1S/C15H18N4O2/c1-9-3-6-13(21-10(2)20)14-11(9)4-5-12(14)18-19-15-16-7-8-17-15/h3,6H,4-5,7-8H2,1-2H3,(H2,16,17,19) |
| InChIKey | PXPRUFDJWGBACB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|