About methanamine;1-(3-nitrofuran-2-yl)pyrazole
methanamine;1-(3-nitrofuran-2-yl)pyrazole (PubChem CID 70620262) has the molecular formula C8H10N4O3
and a molecular weight of 210.19 g/mol. Its IUPAC name is methanamine;1-(3-nitrofuran-2-yl)pyrazole.
Molecular Properties
| Compound Name | methanamine;1-(3-nitrofuran-2-yl)pyrazole |
| PubChem CID | 70620262 |
| Molecular Formula | C8H10N4O3 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | methanamine;1-(3-nitrofuran-2-yl)pyrazole |
| SMILES | CN.O=[N+]([O-])c1ccoc1-n1cccn1 |
| InChI | InChI=1S/C7H5N3O3.CH5N/c11-10(12)6-2-5-13-7(6)9-4-1-3-8-9;1-2/h1-5H;2H2,1H3 |
| InChIKey | QVCIFNMZZUBVFK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 100.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methanamine;1-(3-nitrofuran-2-yl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;1-(3-nitrofuran-2-yl)pyrazole?
The IUPAC name of methanamine;1-(3-nitrofuran-2-yl)pyrazole (CID 70620262) is methanamine;1-(3-nitrofuran-2-yl)pyrazole.
What is the SMILES notation for methanamine;1-(3-nitrofuran-2-yl)pyrazole?
The canonical SMILES for methanamine;1-(3-nitrofuran-2-yl)pyrazole is CN.O=[N+]([O-])c1ccoc1-n1cccn1.
What is the InChIKey of methanamine;1-(3-nitrofuran-2-yl)pyrazole?
The InChIKey is QVCIFNMZZUBVFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O3.CH5N/c11-10(12)6-2-5-13-7(6)9-4-1-3-8-9;1-2/h1-5H;2H2,1H3.
What are the key properties of methanamine;1-(3-nitrofuran-2-yl)pyrazole?
methanamine;1-(3-nitrofuran-2-yl)pyrazole has a molecular weight of 210.19 g/mol, XLogP of 0.95, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;1-(3-nitrofuran-2-yl)pyrazole is sourced from PubChem (CID 70620262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).