C10H18N2O4S — CID 70621008
6-prop-1-enyl-2-prop-1-en-2-yl-1,4,5,6-tetrahydropyrimidine;sulfuric acid (PubChem CID 70621008) has the molecular formula C10H18N2O4S and a molecular weight of 262.33 g/mol. Its IUPAC name is 6-prop-1-enyl-2-prop-1-en-2-yl-1,4,5,6-tetrahydropyrimidine;sulfuric acid.
| Compound Name | 6-prop-1-enyl-2-prop-1-en-2-yl-1,4,5,6-tetrahydropyrimidine;sulfuric acid |
|---|---|
| PubChem CID | 70621008 |
| Molecular Formula | C10H18N2O4S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 6-prop-1-enyl-2-prop-1-en-2-yl-1,4,5,6-tetrahydropyrimidine;sulfuric acid |
| SMILES | C=C(C)C1=NCCC(C=CC)N1.O=S(=O)(O)O |
| InChI | InChI=1S/C10H16N2.H2O4S/c1-4-5-9-6-7-11-10(12-9)8(2)3;1-5(2,3)4/h4-5,9H,2,6-7H2,1,3H3,(H,11,12);(H2,1,2,3,4) |
| InChIKey | SNWLXJLIIVESFH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|