C22H20Br2O3 — CID 70621199
(5aR,6aR,12aR,13aR)-2,10-dibromo-6,6-dimethyl-5a,6a,12,12a,13a,14-hexahydrochromeno[3,2-b]xanthen-13-one (PubChem CID 70621199) has the molecular formula C22H20Br2O3 and a molecular weight of 492.21 g/mol. Its IUPAC name is (5aR,6aR,12aR,13aR)-2,10-dibromo-6,6-dimethyl-5a,6a,12,12a,13a,14-hexahydrochromeno[3,2-b]xanthen-13-one.
| Compound Name | (5aR,6aR,12aR,13aR)-2,10-dibromo-6,6-dimethyl-5a,6a,12,12a,13a,14-hexahydrochromeno[3,2-b]xanthen-13-one |
|---|---|
| PubChem CID | 70621199 |
| Molecular Formula | C22H20Br2O3 |
| Molecular Weight | 492.21 g/mol |
| Exact Mass | 489.98 |
| IUPAC Name | (5aR,6aR,12aR,13aR)-2,10-dibromo-6,6-dimethyl-5a,6a,12,12a,13a,14-hexahydrochromeno[3,2-b]xanthen-13-one |
| SMILES | CC1(C)[C@@H]2Oc3ccc(Br)cc3C[C@H]2C(=O)[C@@H]2Cc3cc(Br)ccc3O[C@H]21 |
| InChI | InChI=1S/C22H20Br2O3/c1-22(2)20-15(9-11-7-13(23)3-5-17(11)26-20)19(25)16-10-12-8-14(24)4-6-18(12)27-21(16)22/h3-8,15-16,20-21H,9-10H2,1-2H3/t15-,16-,20+,21+/m0/s1 |
| InChIKey | DLKXIAGWVLCYQI-LVNJIZSUSA-N |
| XLogP | 5.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.21 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |