About 1-aminopyrrolidin-2-one;carbonic acid
1-aminopyrrolidin-2-one;carbonic acid (PubChem CID 70621208) has the molecular formula C5H10N2O4
and a molecular weight of 162.15 g/mol. Its IUPAC name is 1-aminopyrrolidin-2-one;carbonic acid.
Molecular Properties
| Compound Name | 1-aminopyrrolidin-2-one;carbonic acid |
| PubChem CID | 70621208 |
| Molecular Formula | C5H10N2O4 |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.06 |
| IUPAC Name | 1-aminopyrrolidin-2-one;carbonic acid |
| SMILES | NN1CCCC1=O.O=C(O)O |
| InChI | InChI=1S/C4H8N2O.CH2O3/c5-6-3-1-2-4(6)7;2-1(3)4/h1-3,5H2;(H2,2,3,4) |
| InChIKey | QVICLQGRHQIHOZ-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 1-aminopyrrolidin-2-one;carbonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminopyrrolidin-2-one;carbonic acid?
The IUPAC name of 1-aminopyrrolidin-2-one;carbonic acid (CID 70621208) is 1-aminopyrrolidin-2-one;carbonic acid.
What is the SMILES notation for 1-aminopyrrolidin-2-one;carbonic acid?
The canonical SMILES for 1-aminopyrrolidin-2-one;carbonic acid is NN1CCCC1=O.O=C(O)O.
What is the InChIKey of 1-aminopyrrolidin-2-one;carbonic acid?
The InChIKey is QVICLQGRHQIHOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O.CH2O3/c5-6-3-1-2-4(6)7;2-1(3)4/h1-3,5H2;(H2,2,3,4).
What are the key properties of 1-aminopyrrolidin-2-one;carbonic acid?
1-aminopyrrolidin-2-one;carbonic acid has a molecular weight of 162.15 g/mol, XLogP of -0.30, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminopyrrolidin-2-one;carbonic acid is sourced from PubChem (CID 70621208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).