1-aminopyrrolidin-2-one;carbonic acid

C5H10N2O4 — CID 70621208

IUPAC1-aminopyrrolidin-2-one;carbonic acid
SMILESNN1CCCC1=O.O=C(O)O
InChIInChI=1S/C4H8N2O.CH2O3/c5-6-3-1-2-4(6)7;2-1(3)4/h1-3,5H2;(H2,2,3,4)
InChIKeyQVICLQGRHQIHOZ-UHFFFAOYSA-N
MW162.15 g/mol
LogP-0.30
Rot. Bonds

About 1-aminopyrrolidin-2-one;carbonic acid

1-aminopyrrolidin-2-one;carbonic acid (PubChem CID 70621208) has the molecular formula C5H10N2O4 and a molecular weight of 162.15 g/mol. Its IUPAC name is 1-aminopyrrolidin-2-one;carbonic acid.

Molecular Properties

Compound Name1-aminopyrrolidin-2-one;carbonic acid
PubChem CID70621208
Molecular FormulaC5H10N2O4
Molecular Weight162.15 g/mol
Exact Mass162.06
IUPAC Name1-aminopyrrolidin-2-one;carbonic acid
SMILESNN1CCCC1=O.O=C(O)O
InChIInChI=1S/C4H8N2O.CH2O3/c5-6-3-1-2-4(6)7;2-1(3)4/h1-3,5H2;(H2,2,3,4)
InChIKeyQVICLQGRHQIHOZ-UHFFFAOYSA-N
XLogP-0.30
TPSA103.86 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500162.15
LogP ≤ 5-0.30
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}

Analyze 1-aminopyrrolidin-2-one;carbonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-aminopyrrolidin-2-one;carbonic acid?
The IUPAC name of 1-aminopyrrolidin-2-one;carbonic acid (CID 70621208) is 1-aminopyrrolidin-2-one;carbonic acid.
What is the SMILES notation for 1-aminopyrrolidin-2-one;carbonic acid?
The canonical SMILES for 1-aminopyrrolidin-2-one;carbonic acid is NN1CCCC1=O.O=C(O)O.
What is the InChIKey of 1-aminopyrrolidin-2-one;carbonic acid?
The InChIKey is QVICLQGRHQIHOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O.CH2O3/c5-6-3-1-2-4(6)7;2-1(3)4/h1-3,5H2;(H2,2,3,4).
What are the key properties of 1-aminopyrrolidin-2-one;carbonic acid?
1-aminopyrrolidin-2-one;carbonic acid has a molecular weight of 162.15 g/mol, XLogP of -0.30, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminopyrrolidin-2-one;carbonic acid is sourced from PubChem (CID 70621208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).