C32H51N3 — CID 70621295
N-[[1-(3-aminopropyl)piperidin-4-yl]methyl]-1,5-bis(2,4,6-trimethylphenyl)pentan-1-amine (PubChem CID 70621295) has the molecular formula C32H51N3 and a molecular weight of 477.78 g/mol. Its IUPAC name is N-[[1-(3-aminopropyl)piperidin-4-yl]methyl]-1,5-bis(2,4,6-trimethylphenyl)pentan-1-amine.
| Compound Name | N-[[1-(3-aminopropyl)piperidin-4-yl]methyl]-1,5-bis(2,4,6-trimethylphenyl)pentan-1-amine |
|---|---|
| PubChem CID | 70621295 |
| Molecular Formula | C32H51N3 |
| Molecular Weight | 477.78 g/mol |
| Exact Mass | 477.41 |
| IUPAC Name | N-[[1-(3-aminopropyl)piperidin-4-yl]methyl]-1,5-bis(2,4,6-trimethylphenyl)pentan-1-amine |
| SMILES | Cc1cc(C)c(CCCCC(NCC2CCN(CCCN)CC2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C32H51N3/c1-23-18-25(3)30(26(4)19-23)10-7-8-11-31(32-27(5)20-24(2)21-28(32)6)34-22-29-12-16-35(17-13-29)15-9-14-33/h18-21,29,31,34H,7-17,22,33H2,1-6H3 |
| InChIKey | FEHNKHBSAMUAAF-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.78 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|