C13H18O6 — CID 70621568
methyl 6-butyl-3-methyl-2,4-dioxo-6,6a-dihydro-3aH-furo[3,4-b]furan-3-carboxylate (PubChem CID 70621568) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is methyl 6-butyl-3-methyl-2,4-dioxo-6,6a-dihydro-3aH-furo[3,4-b]furan-3-carboxylate.
| Compound Name | methyl 6-butyl-3-methyl-2,4-dioxo-6,6a-dihydro-3aH-furo[3,4-b]furan-3-carboxylate |
|---|---|
| PubChem CID | 70621568 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | methyl 6-butyl-3-methyl-2,4-dioxo-6,6a-dihydro-3aH-furo[3,4-b]furan-3-carboxylate |
| SMILES | CCCCC1OC(=O)C2C1OC(=O)C2(C)C(=O)OC |
| InChI | InChI=1S/C13H18O6/c1-4-5-6-7-9-8(10(14)18-7)13(2,11(15)17-3)12(16)19-9/h7-9H,4-6H2,1-3H3 |
| InChIKey | HHHXTMAQUKZOGU-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|