C18H12O5 — CID 706218
2-[2-[(1,3-dioxoinden-2-ylidene)methyl]phenoxy]acetic acid (PubChem CID 706218) has the molecular formula C18H12O5 and a molecular weight of 308.29 g/mol. Its IUPAC name is 2-[2-[(1,3-dioxoinden-2-ylidene)methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[(1,3-dioxoinden-2-ylidene)methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 706218 |
| Molecular Formula | C18H12O5 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 2-[2-[(1,3-dioxoinden-2-ylidene)methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccccc1C=C1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H12O5/c19-16(20)10-23-15-8-4-1-5-11(15)9-14-17(21)12-6-2-3-7-13(12)18(14)22/h1-9H,10H2,(H,19,20) |
| InChIKey | UNZWFLSKYYPNMM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|