About 5-hex-1-enyl-2-pentyl-3,4-dihydro-2H-pyrrole
5-hex-1-enyl-2-pentyl-3,4-dihydro-2H-pyrrole (PubChem CID 70622203) has the molecular formula C15H27N
and a molecular weight of 221.39 g/mol. Its IUPAC name is 5-hex-1-enyl-2-pentyl-3,4-dihydro-2H-pyrrole.
Molecular Properties
| Compound Name | 5-hex-1-enyl-2-pentyl-3,4-dihydro-2H-pyrrole |
| PubChem CID | 70622203 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 5-hex-1-enyl-2-pentyl-3,4-dihydro-2H-pyrrole |
| SMILES | CCCCC=CC1=NC(CCCCC)CC1 |
| InChI | InChI=1S/C15H27N/c1-3-5-7-9-11-15-13-12-14(16-15)10-8-6-4-2/h9,11,14H,3-8,10,12-13H2,1-2H3 |
| InChIKey | YEOPLOMKNFFIBU-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-hex-1-enyl-2-pentyl-3,4-dihydro-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hex-1-enyl-2-pentyl-3,4-dihydro-2H-pyrrole?
The IUPAC name of 5-hex-1-enyl-2-pentyl-3,4-dihydro-2H-pyrrole (CID 70622203) is 5-hex-1-enyl-2-pentyl-3,4-dihydro-2H-pyrrole.
What is the SMILES notation for 5-hex-1-enyl-2-pentyl-3,4-dihydro-2H-pyrrole?
The canonical SMILES for 5-hex-1-enyl-2-pentyl-3,4-dihydro-2H-pyrrole is CCCCC=CC1=NC(CCCCC)CC1.
What is the InChIKey of 5-hex-1-enyl-2-pentyl-3,4-dihydro-2H-pyrrole?
The InChIKey is YEOPLOMKNFFIBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N/c1-3-5-7-9-11-15-13-12-14(16-15)10-8-6-4-2/h9,11,14H,3-8,10,12-13H2,1-2H3.
What are the key properties of 5-hex-1-enyl-2-pentyl-3,4-dihydro-2H-pyrrole?
5-hex-1-enyl-2-pentyl-3,4-dihydro-2H-pyrrole has a molecular weight of 221.39 g/mol, XLogP of 4.92, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hex-1-enyl-2-pentyl-3,4-dihydro-2H-pyrrole is sourced from PubChem (CID 70622203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).