About 6-nitro-3,4-dihydro-2H-1,4-benzoxazine
6-nitro-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 7062225) has the molecular formula C8H8N2O3
and a molecular weight of 180.16 g/mol. Its IUPAC name is 6-nitro-3,4-dihydro-2H-1,4-benzoxazine.
Molecular Properties
| Compound Name | 6-nitro-3,4-dihydro-2H-1,4-benzoxazine |
| PubChem CID | 7062225 |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 6-nitro-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)NCCO2 |
| InChI | InChI=1S/C8H8N2O3/c11-10(12)6-1-2-8-7(5-6)9-3-4-13-8/h1-2,5,9H,3-4H2 |
| InChIKey | GZAJZBARYACGSO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-nitro-3,4-dihydro-2H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-nitro-3,4-dihydro-2H-1,4-benzoxazine?
The IUPAC name of 6-nitro-3,4-dihydro-2H-1,4-benzoxazine (CID 7062225) is 6-nitro-3,4-dihydro-2H-1,4-benzoxazine.
What is the SMILES notation for 6-nitro-3,4-dihydro-2H-1,4-benzoxazine?
The canonical SMILES for 6-nitro-3,4-dihydro-2H-1,4-benzoxazine is O=[N+]([O-])c1ccc2c(c1)NCCO2.
What is the InChIKey of 6-nitro-3,4-dihydro-2H-1,4-benzoxazine?
The InChIKey is GZAJZBARYACGSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O3/c11-10(12)6-1-2-8-7(5-6)9-3-4-13-8/h1-2,5,9H,3-4H2.
What are the key properties of 6-nitro-3,4-dihydro-2H-1,4-benzoxazine?
6-nitro-3,4-dihydro-2H-1,4-benzoxazine has a molecular weight of 180.16 g/mol, XLogP of 1.40, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-nitro-3,4-dihydro-2H-1,4-benzoxazine is sourced from PubChem (CID 7062225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).