About 3-(5-ethyl-2,4-dimethyl-3H-pyridin-4-yl)cyclohex-2-en-1-one
3-(5-ethyl-2,4-dimethyl-3H-pyridin-4-yl)cyclohex-2-en-1-one (PubChem CID 70622641) has the molecular formula C15H21NO
and a molecular weight of 231.34 g/mol. Its IUPAC name is 3-(5-ethyl-2,4-dimethyl-3H-pyridin-4-yl)cyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 3-(5-ethyl-2,4-dimethyl-3H-pyridin-4-yl)cyclohex-2-en-1-one |
| PubChem CID | 70622641 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 3-(5-ethyl-2,4-dimethyl-3H-pyridin-4-yl)cyclohex-2-en-1-one |
| SMILES | CCC1=CN=C(C)CC1(C)C1=CC(=O)CCC1 |
| InChI | InChI=1S/C15H21NO/c1-4-12-10-16-11(2)9-15(12,3)13-6-5-7-14(17)8-13/h8,10H,4-7,9H2,1-3H3 |
| InChIKey | BGEZESMGBSNITB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(5-ethyl-2,4-dimethyl-3H-pyridin-4-yl)cyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-ethyl-2,4-dimethyl-3H-pyridin-4-yl)cyclohex-2-en-1-one?
The IUPAC name of 3-(5-ethyl-2,4-dimethyl-3H-pyridin-4-yl)cyclohex-2-en-1-one (CID 70622641) is 3-(5-ethyl-2,4-dimethyl-3H-pyridin-4-yl)cyclohex-2-en-1-one.
What is the SMILES notation for 3-(5-ethyl-2,4-dimethyl-3H-pyridin-4-yl)cyclohex-2-en-1-one?
The canonical SMILES for 3-(5-ethyl-2,4-dimethyl-3H-pyridin-4-yl)cyclohex-2-en-1-one is CCC1=CN=C(C)CC1(C)C1=CC(=O)CCC1.
What is the InChIKey of 3-(5-ethyl-2,4-dimethyl-3H-pyridin-4-yl)cyclohex-2-en-1-one?
The InChIKey is BGEZESMGBSNITB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO/c1-4-12-10-16-11(2)9-15(12,3)13-6-5-7-14(17)8-13/h8,10H,4-7,9H2,1-3H3.
What are the key properties of 3-(5-ethyl-2,4-dimethyl-3H-pyridin-4-yl)cyclohex-2-en-1-one?
3-(5-ethyl-2,4-dimethyl-3H-pyridin-4-yl)cyclohex-2-en-1-one has a molecular weight of 231.34 g/mol, XLogP of 3.83, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-ethyl-2,4-dimethyl-3H-pyridin-4-yl)cyclohex-2-en-1-one is sourced from PubChem (CID 70622641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).