C14H15NO6 — CID 70622735
4-ethyl-6-(2-nitrophenyl)-3,5-dioxohexanoic acid (PubChem CID 70622735) has the molecular formula C14H15NO6 and a molecular weight of 293.27 g/mol. Its IUPAC name is 4-ethyl-6-(2-nitrophenyl)-3,5-dioxohexanoic acid.
| Compound Name | 4-ethyl-6-(2-nitrophenyl)-3,5-dioxohexanoic acid |
|---|---|
| PubChem CID | 70622735 |
| Molecular Formula | C14H15NO6 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 4-ethyl-6-(2-nitrophenyl)-3,5-dioxohexanoic acid |
| SMILES | CCC(C(=O)CC(=O)O)C(=O)Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H15NO6/c1-2-10(13(17)8-14(18)19)12(16)7-9-5-3-4-6-11(9)15(20)21/h3-6,10H,2,7-8H2,1H3,(H,18,19) |
| InChIKey | TUNNBMFBDGHKSW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 114.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|