C19H27NO7 — CID 70622865
but-2-enedioic acid;N-[(6,7-dimethoxy-3,4-dihydro-1H-isochromen-1-yl)methyl]propan-2-amine (PubChem CID 70622865) has the molecular formula C19H27NO7 and a molecular weight of 381.43 g/mol. Its IUPAC name is but-2-enedioic acid;N-[(6,7-dimethoxy-3,4-dihydro-1H-isochromen-1-yl)methyl]propan-2-amine.
| Compound Name | but-2-enedioic acid;N-[(6,7-dimethoxy-3,4-dihydro-1H-isochromen-1-yl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 70622865 |
| Molecular Formula | C19H27NO7 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | but-2-enedioic acid;N-[(6,7-dimethoxy-3,4-dihydro-1H-isochromen-1-yl)methyl]propan-2-amine |
| SMILES | COc1cc2c(cc1OC)C(CNC(C)C)OCC2.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C15H23NO3.C4H4O4/c1-10(2)16-9-15-12-8-14(18-4)13(17-3)7-11(12)5-6-19-15;5-3(6)1-2-4(7)8/h7-8,10,15-16H,5-6,9H2,1-4H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | ZLOPMJBHUICRNP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|