C13H14N3O5- — CID 7062297
1-(3-carbamoyl-4-nitrophenyl)piperidine-4-carboxylate (PubChem CID 7062297) has the molecular formula C13H14N3O5- and a molecular weight of 292.27 g/mol. Its IUPAC name is 1-(3-carbamoyl-4-nitrophenyl)piperidine-4-carboxylate.
| Compound Name | 1-(3-carbamoyl-4-nitrophenyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 7062297 |
| Molecular Formula | C13H14N3O5- |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 1-(3-carbamoyl-4-nitrophenyl)piperidine-4-carboxylate |
| SMILES | NC(=O)c1cc(N2CCC(C(=O)[O-])CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15N3O5/c14-12(17)10-7-9(1-2-11(10)16(20)21)15-5-3-8(4-6-15)13(18)19/h1-2,7-8H,3-6H2,(H2,14,17)(H,18,19)/p-1 |
| InChIKey | XYKXNPMCXVIDMQ-UHFFFAOYSA-M |
| XLogP | -0.34 |
| TPSA | 129.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|