C12H18ClN3O3S — CID 70623191
4-chloro-N-(6-hydrazinyl-6-oxohexyl)benzenesulfonamide (PubChem CID 70623191) has the molecular formula C12H18ClN3O3S and a molecular weight of 319.81 g/mol. Its IUPAC name is 4-chloro-N-(6-hydrazinyl-6-oxohexyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(6-hydrazinyl-6-oxohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 70623191 |
| Molecular Formula | C12H18ClN3O3S |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 4-chloro-N-(6-hydrazinyl-6-oxohexyl)benzenesulfonamide |
| SMILES | NNC(=O)CCCCCNS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H18ClN3O3S/c13-10-5-7-11(8-6-10)20(18,19)15-9-3-1-2-4-12(17)16-14/h5-8,15H,1-4,9,14H2,(H,16,17) |
| InChIKey | FCCNTDRNCGZIGT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|