C17H12Cl2NO3- — CID 7062338
(3R)-3-(2,3-dichlorophenyl)-3-(3-oxo-1H-isoindol-2-yl)propanoate (PubChem CID 7062338) has the molecular formula C17H12Cl2NO3- and a molecular weight of 349.19 g/mol. Its IUPAC name is (3R)-3-(2,3-dichlorophenyl)-3-(3-oxo-1H-isoindol-2-yl)propanoate.
| Compound Name | (3R)-3-(2,3-dichlorophenyl)-3-(3-oxo-1H-isoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 7062338 |
| Molecular Formula | C17H12Cl2NO3- |
| Molecular Weight | 349.19 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | (3R)-3-(2,3-dichlorophenyl)-3-(3-oxo-1H-isoindol-2-yl)propanoate |
| SMILES | O=C([O-])C[C@H](c1cccc(Cl)c1Cl)N1Cc2ccccc2C1=O |
| InChI | InChI=1S/C17H13Cl2NO3/c18-13-7-3-6-12(16(13)19)14(8-15(21)22)20-9-10-4-1-2-5-11(10)17(20)23/h1-7,14H,8-9H2,(H,21,22)/p-1/t14-/m1/s1 |
| InChIKey | XKBSQSYLSYMRRD-CQSZACIVSA-M |
| XLogP | 2.83 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.19 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |