C20H27NO3 — CID 70623561
(3aS,5aS,9aR,9bS)-6-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3a-methyl-1,2,4,5,5a,6,8,9,9a,9b-decahydrocyclopenta[a]naphthalene-3,7-dione (PubChem CID 70623561) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is (3aS,5aS,9aR,9bS)-6-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3a-methyl-1,2,4,5,5a,6,8,9,9a,9b-decahydrocyclopenta[a]naphthalene-3,7-dione.
| Compound Name | (3aS,5aS,9aR,9bS)-6-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3a-methyl-1,2,4,5,5a,6,8,9,9a,9b-decahydrocyclopenta[a]naphthalene-3,7-dione |
|---|---|
| PubChem CID | 70623561 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | (3aS,5aS,9aR,9bS)-6-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3a-methyl-1,2,4,5,5a,6,8,9,9a,9b-decahydrocyclopenta[a]naphthalene-3,7-dione |
| SMILES | Cc1noc(C)c1CC1C(=O)CC[C@@H]2[C@@H]1CC[C@]1(C)C(=O)CC[C@@H]21 |
| InChI | InChI=1S/C20H27NO3/c1-11-15(12(2)24-21-11)10-16-13-8-9-20(3)17(5-7-19(20)23)14(13)4-6-18(16)22/h13-14,16-17H,4-10H2,1-3H3/t13-,14+,16?,17-,20-/m0/s1 |
| InChIKey | KKGTYANRUOHFHJ-IPMYIMRSSA-N |
| XLogP | 3.82 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |