C11H11NO5 — CID 70623858
1-hydroxy-3-(2-methyl-4-oxohexa-2,5-dienoyl)pyrrolidine-2,5-dione (PubChem CID 70623858) has the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. Its IUPAC name is 1-hydroxy-3-(2-methyl-4-oxohexa-2,5-dienoyl)pyrrolidine-2,5-dione.
| Compound Name | 1-hydroxy-3-(2-methyl-4-oxohexa-2,5-dienoyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 70623858 |
| Molecular Formula | C11H11NO5 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 1-hydroxy-3-(2-methyl-4-oxohexa-2,5-dienoyl)pyrrolidine-2,5-dione |
| SMILES | C=CC(=O)C=C(C)C(=O)C1CC(=O)N(O)C1=O |
| InChI | InChI=1S/C11H11NO5/c1-3-7(13)4-6(2)10(15)8-5-9(14)12(17)11(8)16/h3-4,8,17H,1,5H2,2H3 |
| InChIKey | ZUVNILARCBYDNW-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|