C22H40O6 — CID 70624123
(2R,3R,4R,6R)-3-(3-hydroxypropyl)-6-methoxy-2-[3-(oxan-2-yloxy)oct-1-enyl]oxan-4-ol (PubChem CID 70624123) has the molecular formula C22H40O6 and a molecular weight of 400.56 g/mol. Its IUPAC name is (2R,3R,4R,6R)-3-(3-hydroxypropyl)-6-methoxy-2-[3-(oxan-2-yloxy)oct-1-enyl]oxan-4-ol.
| Compound Name | (2R,3R,4R,6R)-3-(3-hydroxypropyl)-6-methoxy-2-[3-(oxan-2-yloxy)oct-1-enyl]oxan-4-ol |
|---|---|
| PubChem CID | 70624123 |
| Molecular Formula | C22H40O6 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | (2R,3R,4R,6R)-3-(3-hydroxypropyl)-6-methoxy-2-[3-(oxan-2-yloxy)oct-1-enyl]oxan-4-ol |
| SMILES | CCCCCC(C=C[C@H]1O[C@@H](OC)C[C@@H](O)[C@H]1CCCO)OC1CCCCO1 |
| InChI | InChI=1S/C22H40O6/c1-3-4-5-9-17(27-21-11-6-7-15-26-21)12-13-20-18(10-8-14-23)19(24)16-22(25-2)28-20/h12-13,17-24H,3-11,14-16H2,1-2H3/t17?,18-,19-,20-,21?,22-/m1/s1 |
| InChIKey | HJTIODMJPVOARW-QDHDCOPKSA-N |
| XLogP | 3.55 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|