C12H8ClNO — CID 70624212
12-(chloromethyl)-8-oxa-10-azatricyclo[7.4.0.02,6]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 70624212) has the molecular formula C12H8ClNO and a molecular weight of 217.66 g/mol. Its IUPAC name is 12-(chloromethyl)-8-oxa-10-azatricyclo[7.4.0.02,6]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 12-(chloromethyl)-8-oxa-10-azatricyclo[7.4.0.02,6]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 70624212 |
| Molecular Formula | C12H8ClNO |
| Molecular Weight | 217.66 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | 12-(chloromethyl)-8-oxa-10-azatricyclo[7.4.0.02,6]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | ClCc1cnc2occ3cccc-3c2c1 |
| InChI | InChI=1S/C12H8ClNO/c13-5-8-4-11-10-3-1-2-9(10)7-15-12(11)14-6-8/h1-4,6-7H,5H2 |
| InChIKey | FDGUEQXFQAFQAZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.66 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|