C17H26O4 — CID 70624214
[(1S)-2-methyl-6-oxo-5-(3-oxobutyl)-2,3,4,4a,5,7,8,8a-octahydro-1H-naphthalen-1-yl] acetate (PubChem CID 70624214) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is [(1S)-2-methyl-6-oxo-5-(3-oxobutyl)-2,3,4,4a,5,7,8,8a-octahydro-1H-naphthalen-1-yl] acetate.
| Compound Name | [(1S)-2-methyl-6-oxo-5-(3-oxobutyl)-2,3,4,4a,5,7,8,8a-octahydro-1H-naphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 70624214 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | [(1S)-2-methyl-6-oxo-5-(3-oxobutyl)-2,3,4,4a,5,7,8,8a-octahydro-1H-naphthalen-1-yl] acetate |
| SMILES | CC(=O)CCC1C(=O)CCC2C1CCC(C)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C17H26O4/c1-10-4-6-13-14(7-5-11(2)18)16(20)9-8-15(13)17(10)21-12(3)19/h10,13-15,17H,4-9H2,1-3H3/t10?,13?,14?,15?,17-/m0/s1 |
| InChIKey | TYFBQORWAQHJAJ-KHMMPIACSA-N |
| XLogP | 2.93 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |