About [3-(1,3-benzothiazol-2-yl)-2-oxo-1-pent-3-ynylimidazolidin-4-yl] furan-2-carboxylate
[3-(1,3-benzothiazol-2-yl)-2-oxo-1-pent-3-ynylimidazolidin-4-yl] furan-2-carboxylate (PubChem CID 70624496) has the molecular formula C20H17N3O4S
and a molecular weight of 395.44 g/mol. Its IUPAC name is [3-(1,3-benzothiazol-2-yl)-2-oxo-1-pent-3-ynylimidazolidin-4-yl] furan-2-carboxylate.
Molecular Properties
| Compound Name | [3-(1,3-benzothiazol-2-yl)-2-oxo-1-pent-3-ynylimidazolidin-4-yl] furan-2-carboxylate |
| PubChem CID | 70624496 |
| Molecular Formula | C20H17N3O4S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | [3-(1,3-benzothiazol-2-yl)-2-oxo-1-pent-3-ynylimidazolidin-4-yl] furan-2-carboxylate |
| SMILES | CC#CCCN1CC(OC(=O)c2ccco2)N(c2nc3ccccc3s2)C1=O |
| InChI | InChI=1S/C20H17N3O4S/c1-2-3-6-11-22-13-17(27-18(24)15-9-7-12-26-15)23(20(22)25)19-21-14-8-4-5-10-16(14)28-19/h4-5,7-10,12,17H,6,11,13H2,1H3 |
| InChIKey | YPYRBDXCQGWOOP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-(1,3-benzothiazol-2-yl)-2-oxo-1-pent-3-ynylimidazolidin-4-yl] furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,3-benzothiazol-2-yl)-2-oxo-1-pent-3-ynylimidazolidin-4-yl] furan-2-carboxylate?
The IUPAC name of [3-(1,3-benzothiazol-2-yl)-2-oxo-1-pent-3-ynylimidazolidin-4-yl] furan-2-carboxylate (CID 70624496) is [3-(1,3-benzothiazol-2-yl)-2-oxo-1-pent-3-ynylimidazolidin-4-yl] furan-2-carboxylate.
What is the SMILES notation for [3-(1,3-benzothiazol-2-yl)-2-oxo-1-pent-3-ynylimidazolidin-4-yl] furan-2-carboxylate?
The canonical SMILES for [3-(1,3-benzothiazol-2-yl)-2-oxo-1-pent-3-ynylimidazolidin-4-yl] furan-2-carboxylate is CC#CCCN1CC(OC(=O)c2ccco2)N(c2nc3ccccc3s2)C1=O.
What is the InChIKey of [3-(1,3-benzothiazol-2-yl)-2-oxo-1-pent-3-ynylimidazolidin-4-yl] furan-2-carboxylate?
The InChIKey is YPYRBDXCQGWOOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3O4S/c1-2-3-6-11-22-13-17(27-18(24)15-9-7-12-26-15)23(20(22)25)19-21-14-8-4-5-10-16(14)28-19/h4-5,7-10,12,17H,6,11,13H2,1H3.
What are the key properties of [3-(1,3-benzothiazol-2-yl)-2-oxo-1-pent-3-ynylimidazolidin-4-yl] furan-2-carboxylate?
[3-(1,3-benzothiazol-2-yl)-2-oxo-1-pent-3-ynylimidazolidin-4-yl] furan-2-carboxylate has a molecular weight of 395.44 g/mol, XLogP of 3.73, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,3-benzothiazol-2-yl)-2-oxo-1-pent-3-ynylimidazolidin-4-yl] furan-2-carboxylate is sourced from PubChem (CID 70624496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).