C19H36O6S — CID 70624754
7-[(2S,3S,4R)-4-hydroxy-3-(8-hydroxyoctyl)-1,1-dioxothiolan-2-yl]heptanoic acid (PubChem CID 70624754) has the molecular formula C19H36O6S and a molecular weight of 392.56 g/mol. Its IUPAC name is 7-[(2S,3S,4R)-4-hydroxy-3-(8-hydroxyoctyl)-1,1-dioxothiolan-2-yl]heptanoic acid.
| Compound Name | 7-[(2S,3S,4R)-4-hydroxy-3-(8-hydroxyoctyl)-1,1-dioxothiolan-2-yl]heptanoic acid |
|---|---|
| PubChem CID | 70624754 |
| Molecular Formula | C19H36O6S |
| Molecular Weight | 392.56 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 7-[(2S,3S,4R)-4-hydroxy-3-(8-hydroxyoctyl)-1,1-dioxothiolan-2-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@H]1[C@@H](CCCCCCCCO)[C@@H](O)CS1(=O)=O |
| InChI | InChI=1S/C19H36O6S/c20-14-10-6-2-1-3-7-11-16-17(21)15-26(24,25)18(16)12-8-4-5-9-13-19(22)23/h16-18,20-21H,1-15H2,(H,22,23)/t16-,17-,18-/m0/s1 |
| InChIKey | LPMBKPMDISYKCX-BZSNNMDCSA-N |
| XLogP | 2.91 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.56 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|