C10H13N3 — CID 70625315
2,3,4,4a,5,9-hexahydro-1H-pyrrolo[2,3-f]quinoxaline (PubChem CID 70625315) has the molecular formula C10H13N3 and a molecular weight of 175.24 g/mol. Its IUPAC name is 2,3,4,4a,5,9-hexahydro-1H-pyrrolo[2,3-f]quinoxaline.
| Compound Name | 2,3,4,4a,5,9-hexahydro-1H-pyrrolo[2,3-f]quinoxaline |
|---|---|
| PubChem CID | 70625315 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 2,3,4,4a,5,9-hexahydro-1H-pyrrolo[2,3-f]quinoxaline |
| SMILES | C1=c2cc[nH]c2=C2NCCNC2C1 |
| InChI | InChI=1S/C10H13N3/c1-2-8-10(13-6-5-11-8)9-7(1)3-4-12-9/h1,3-4,8,11-13H,2,5-6H2 |
| InChIKey | MWJGPZIJPIOCQC-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |